C14H16F3N — CID 65171795
3-[[3-(trifluoromethyl)phenyl]methyl]cyclohex-2-en-1-amine (PubChem CID 65171795) has the molecular formula C14H16F3N and a molecular weight of 255.28 g/mol. Its IUPAC name is 3-[[3-(trifluoromethyl)phenyl]methyl]cyclohex-2-en-1-amine.
| Compound Name | 3-[[3-(trifluoromethyl)phenyl]methyl]cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 65171795 |
| Molecular Formula | C14H16F3N |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 3-[[3-(trifluoromethyl)phenyl]methyl]cyclohex-2-en-1-amine |
| SMILES | NC1C=C(Cc2cccc(C(F)(F)F)c2)CCC1 |
| InChI | InChI=1S/C14H16F3N/c15-14(16,17)12-5-1-3-10(8-12)7-11-4-2-6-13(18)9-11/h1,3,5,8-9,13H,2,4,6-7,18H2 |
| InChIKey | KGUYCHLFMIDULQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|