C25H28F6N2O — CID 102246471
1,5-bis[[3-(trifluoromethyl)phenyl]methyl]-1,5-diazacycloundecan-6-one (PubChem CID 102246471) has the molecular formula C25H28F6N2O and a molecular weight of 486.50 g/mol. Its IUPAC name is 1,5-bis[[3-(trifluoromethyl)phenyl]methyl]-1,5-diazacycloundecan-6-one.
| Compound Name | 1,5-bis[[3-(trifluoromethyl)phenyl]methyl]-1,5-diazacycloundecan-6-one |
|---|---|
| PubChem CID | 102246471 |
| Molecular Formula | C25H28F6N2O |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 1,5-bis[[3-(trifluoromethyl)phenyl]methyl]-1,5-diazacycloundecan-6-one |
| SMILES | O=C1CCCCCN(Cc2cccc(C(F)(F)F)c2)CCCN1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H28F6N2O/c26-24(27,28)21-9-4-7-19(15-21)17-32-12-3-1-2-11-23(34)33(14-6-13-32)18-20-8-5-10-22(16-20)25(29,30)31/h4-5,7-10,15-16H,1-3,6,11-14,17-18H2 |
| InChIKey | LMJKAPSYMDNWDT-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |