C33H28Cl2FN3O3S — CID 118329982
6-[bis(4-chlorophenyl)methyl]-4-[[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]amino]-1H-quinolin-2-one (PubChem CID 118329982) has the molecular formula C33H28Cl2FN3O3S and a molecular weight of 636.58 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-4-[[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]amino]-1H-quinolin-2-one.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-4-[[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]amino]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 118329982 |
| Molecular Formula | C33H28Cl2FN3O3S |
| Molecular Weight | 636.58 g/mol |
| Exact Mass | 635.12 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-4-[[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]amino]-1H-quinolin-2-one |
| SMILES | O=c1cc(NC2CCN(S(=O)(=O)c3cccc(F)c3)CC2)c2cc(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)ccc2[nH]1 |
| InChI | InChI=1S/C33H28Cl2FN3O3S/c34-24-9-4-21(5-10-24)33(22-6-11-25(35)12-7-22)23-8-13-30-29(18-23)31(20-32(40)38-30)37-27-14-16-39(17-15-27)43(41,42)28-3-1-2-26(36)19-28/h1-13,18-20,27,33H,14-17H2,(H2,37,38,40) |
| InChIKey | XYSBXQKVIGOOPR-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.58 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|