C28H22Cl2N2O3 — CID 118341735
4-[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 118341735) has the molecular formula C28H22Cl2N2O3 and a molecular weight of 505.40 g/mol. Its IUPAC name is 4-[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | 4-[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 118341735 |
| Molecular Formula | C28H22Cl2N2O3 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 4-[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | O=C(O)N1CC=C(c2cc(=O)[nH]c3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)CC1 |
| InChI | InChI=1S/C28H22Cl2N2O3/c29-21-6-1-18(2-7-21)27(19-3-8-22(30)9-4-19)20-5-10-25-24(15-20)23(16-26(33)31-25)17-11-13-32(14-12-17)28(34)35/h1-11,15-16,27H,12-14H2,(H,31,33)(H,34,35) |
| InChIKey | OMIBDLHKQAAUOF-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|