C33H29Cl2N3O3S — CID 118324141
4-[[1-(benzenesulfonyl)piperidin-4-yl]amino]-6-[bis(4-chlorophenyl)methyl]-1H-quinolin-2-one (PubChem CID 118324141) has the molecular formula C33H29Cl2N3O3S and a molecular weight of 618.59 g/mol. Its IUPAC name is 4-[[1-(benzenesulfonyl)piperidin-4-yl]amino]-6-[bis(4-chlorophenyl)methyl]-1H-quinolin-2-one.
| Compound Name | 4-[[1-(benzenesulfonyl)piperidin-4-yl]amino]-6-[bis(4-chlorophenyl)methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 118324141 |
| Molecular Formula | C33H29Cl2N3O3S |
| Molecular Weight | 618.59 g/mol |
| Exact Mass | 617.13 |
| IUPAC Name | 4-[[1-(benzenesulfonyl)piperidin-4-yl]amino]-6-[bis(4-chlorophenyl)methyl]-1H-quinolin-2-one |
| SMILES | O=c1cc(NC2CCN(S(=O)(=O)c3ccccc3)CC2)c2cc(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)ccc2[nH]1 |
| InChI | InChI=1S/C33H29Cl2N3O3S/c34-25-11-6-22(7-12-25)33(23-8-13-26(35)14-9-23)24-10-15-30-29(20-24)31(21-32(39)37-30)36-27-16-18-38(19-17-27)42(40,41)28-4-2-1-3-5-28/h1-15,20-21,27,33H,16-19H2,(H2,36,37,39) |
| InChIKey | SPSDQCVVNWOHJA-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.59 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|