C29H27ClF3N3O4S — CID 118323989
6-[(4-chlorophenyl)-(4-methoxyphenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]-1H-quinolin-2-one (PubChem CID 118323989) has the molecular formula C29H27ClF3N3O4S and a molecular weight of 606.07 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)-(4-methoxyphenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]-1H-quinolin-2-one.
| Compound Name | 6-[(4-chlorophenyl)-(4-methoxyphenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 118323989 |
| Molecular Formula | C29H27ClF3N3O4S |
| Molecular Weight | 606.07 g/mol |
| Exact Mass | 605.14 |
| IUPAC Name | 6-[(4-chlorophenyl)-(4-methoxyphenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]-1H-quinolin-2-one |
| SMILES | COc1ccc(C(c2ccc(Cl)cc2)c2ccc3[nH]c(=O)cc(NC4CCN(S(=O)(=O)C(F)(F)F)CC4)c3c2)cc1 |
| InChI | InChI=1S/C29H27ClF3N3O4S/c1-40-23-9-4-19(5-10-23)28(18-2-7-21(30)8-3-18)20-6-11-25-24(16-20)26(17-27(37)35-25)34-22-12-14-36(15-13-22)41(38,39)29(31,32)33/h2-11,16-17,22,28H,12-15H2,1H3,(H2,34,35,37) |
| InChIKey | MBICEAHDHQCQLB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.07 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|