C35H38Cl2F3N3O4S — CID 162598573
6-[bis(4-chlorophenyl)methyl]-2-(4-propan-2-yloxybutan-2-yloxy)-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]quinolin-4-amine (PubChem CID 162598573) has the molecular formula C35H38Cl2F3N3O4S and a molecular weight of 724.67 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-2-(4-propan-2-yloxybutan-2-yloxy)-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]quinolin-4-amine.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-2-(4-propan-2-yloxybutan-2-yloxy)-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]quinolin-4-amine |
|---|---|
| PubChem CID | 162598573 |
| Molecular Formula | C35H38Cl2F3N3O4S |
| Molecular Weight | 724.67 g/mol |
| Exact Mass | 723.19 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-2-(4-propan-2-yloxybutan-2-yloxy)-N-[1-(trifluoromethylsulfonyl)piperidin-4-yl]quinolin-4-amine |
| SMILES | CC(C)OCCC(C)Oc1cc(NC2CCN(S(=O)(=O)C(F)(F)F)CC2)c2cc(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)ccc2n1 |
| InChI | InChI=1S/C35H38Cl2F3N3O4S/c1-22(2)46-19-16-23(3)47-33-21-32(41-29-14-17-43(18-15-29)48(44,45)35(38,39)40)30-20-26(8-13-31(30)42-33)34(24-4-9-27(36)10-5-24)25-6-11-28(37)12-7-25/h4-13,20-23,29,34H,14-19H2,1-3H3,(H,41,42) |
| InChIKey | OVKBJTLTDZZWMR-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.67 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|