C33H32Cl2F3N3O6S — CID 126630136
3-[2-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]oxyethoxy]propanoic acid (PubChem CID 126630136) has the molecular formula C33H32Cl2F3N3O6S and a molecular weight of 726.60 g/mol. Its IUPAC name is 3-[2-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]oxyethoxy]propanoic acid.
| Compound Name | 3-[2-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]oxyethoxy]propanoic acid |
|---|---|
| PubChem CID | 126630136 |
| Molecular Formula | C33H32Cl2F3N3O6S |
| Molecular Weight | 726.60 g/mol |
| Exact Mass | 725.13 |
| IUPAC Name | 3-[2-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]oxyethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCOc1cc(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc2c(NC3CCN(S(=O)(=O)C(F)(F)F)CC3)ccnc12 |
| InChI | InChI=1S/C33H32Cl2F3N3O6S/c34-24-5-1-21(2-6-24)31(22-3-7-25(35)8-4-22)23-19-27-28(40-26-10-14-41(15-11-26)48(44,45)33(36,37)38)9-13-39-32(27)29(20-23)47-18-17-46-16-12-30(42)43/h1-9,13,19-20,26,31H,10-12,14-18H2,(H,39,40)(H,42,43) |
| InChIKey | XISBPXVAJLYJIJ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.60 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|