C34H35Cl2F3N4O5S — CID 162598571
3-[3-[[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]amino]propoxy]propanoic acid (PubChem CID 162598571) has the molecular formula C34H35Cl2F3N4O5S and a molecular weight of 739.64 g/mol. Its IUPAC name is 3-[3-[[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]amino]propoxy]propanoic acid.
| Compound Name | 3-[3-[[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]amino]propoxy]propanoic acid |
|---|---|
| PubChem CID | 162598571 |
| Molecular Formula | C34H35Cl2F3N4O5S |
| Molecular Weight | 739.64 g/mol |
| Exact Mass | 738.17 |
| IUPAC Name | 3-[3-[[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]amino]propoxy]propanoic acid |
| SMILES | O=C(O)CCOCCCNc1cc(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc2c(NC3CCN(S(=O)(=O)C(F)(F)F)CC3)ccnc12 |
| InChI | InChI=1S/C34H35Cl2F3N4O5S/c35-25-6-2-22(3-7-25)32(23-4-8-26(36)9-5-23)24-20-28-29(42-27-11-16-43(17-12-27)49(46,47)34(37,38)39)10-15-41-33(28)30(21-24)40-14-1-18-48-19-13-31(44)45/h2-10,15,20-21,27,32,40H,1,11-14,16-19H2,(H,41,42)(H,44,45) |
| InChIKey | QJHOLIAWUOBTRV-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.64 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|