C32H27Cl2FN4O2S — CID 118916113
6-[bis(4-chlorophenyl)methyl]-N-[1-(2-fluorophenyl)sulfonylpiperidin-4-yl]quinazolin-4-amine (PubChem CID 118916113) has the molecular formula C32H27Cl2FN4O2S and a molecular weight of 621.57 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-N-[1-(2-fluorophenyl)sulfonylpiperidin-4-yl]quinazolin-4-amine.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-N-[1-(2-fluorophenyl)sulfonylpiperidin-4-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 118916113 |
| Molecular Formula | C32H27Cl2FN4O2S |
| Molecular Weight | 621.57 g/mol |
| Exact Mass | 620.12 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-N-[1-(2-fluorophenyl)sulfonylpiperidin-4-yl]quinazolin-4-amine |
| SMILES | O=S(=O)(c1ccccc1F)N1CCC(Nc2ncnc3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)CC1 |
| InChI | InChI=1S/C32H27Cl2FN4O2S/c33-24-10-5-21(6-11-24)31(22-7-12-25(34)13-8-22)23-9-14-29-27(19-23)32(37-20-36-29)38-26-15-17-39(18-16-26)42(40,41)30-4-2-1-3-28(30)35/h1-14,19-20,26,31H,15-18H2,(H,36,37,38) |
| InChIKey | SAFWCCQFWVSEOL-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.57 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|