C33H28Cl2N4O — CID 118916273
[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]-phenylmethanone (PubChem CID 118916273) has the molecular formula C33H28Cl2N4O and a molecular weight of 567.52 g/mol. Its IUPAC name is [4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]-phenylmethanone.
| Compound Name | [4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 118916273 |
| Molecular Formula | C33H28Cl2N4O |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | [4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCC(Nc2ncnc3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)CC1 |
| InChI | InChI=1S/C33H28Cl2N4O/c34-26-11-6-22(7-12-26)31(23-8-13-27(35)14-9-23)25-10-15-30-29(20-25)32(37-21-36-30)38-28-16-18-39(19-17-28)33(40)24-4-2-1-3-5-24/h1-15,20-21,28,31H,16-19H2,(H,36,37,38) |
| InChIKey | JNNDMPVOBHBNPQ-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|