C29H26Cl2N4O3 — CID 118916159
3-[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]-3-oxopropanoic acid (PubChem CID 118916159) has the molecular formula C29H26Cl2N4O3 and a molecular weight of 549.46 g/mol. Its IUPAC name is 3-[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]-3-oxopropanoic acid.
| Compound Name | 3-[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 118916159 |
| Molecular Formula | C29H26Cl2N4O3 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 3-[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)N1CCC(Nc2ncnc3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)CC1 |
| InChI | InChI=1S/C29H26Cl2N4O3/c30-21-6-1-18(2-7-21)28(19-3-8-22(31)9-4-19)20-5-10-25-24(15-20)29(33-17-32-25)34-23-11-13-35(14-12-23)26(36)16-27(37)38/h1-10,15,17,23,28H,11-14,16H2,(H,37,38)(H,32,33,34) |
| InChIKey | GNRWXFLGIIAAIR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|