C33H28Cl2N4O2 — CID 118916047
3-[[3-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]pyrrolidin-1-yl]methyl]benzoic acid (PubChem CID 118916047) has the molecular formula C33H28Cl2N4O2 and a molecular weight of 583.52 g/mol. Its IUPAC name is 3-[[3-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]pyrrolidin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[3-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]pyrrolidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 118916047 |
| Molecular Formula | C33H28Cl2N4O2 |
| Molecular Weight | 583.52 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | 3-[[3-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]pyrrolidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCC(Nc3ncnc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc34)C2)c1 |
| InChI | InChI=1S/C33H28Cl2N4O2/c34-26-9-4-22(5-10-26)31(23-6-11-27(35)12-7-23)24-8-13-30-29(17-24)32(37-20-36-30)38-28-14-15-39(19-28)18-21-2-1-3-25(16-21)33(40)41/h1-13,16-17,20,28,31H,14-15,18-19H2,(H,40,41)(H,36,37,38) |
| InChIKey | SECUFPQMJKPVMN-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.52 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|