C30H23Cl2N3O2 — CID 118916124
methyl 4-[[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]methyl]benzoate (PubChem CID 118916124) has the molecular formula C30H23Cl2N3O2 and a molecular weight of 528.44 g/mol. Its IUPAC name is methyl 4-[[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 118916124 |
| Molecular Formula | C30H23Cl2N3O2 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | methyl 4-[[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNc2ncnc3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)cc1 |
| InChI | InChI=1S/C30H23Cl2N3O2/c1-37-30(36)22-4-2-19(3-5-22)17-33-29-26-16-23(10-15-27(26)34-18-35-29)28(20-6-11-24(31)12-7-20)21-8-13-25(32)14-9-21/h2-16,18,28H,17H2,1H3,(H,33,34,35) |
| InChIKey | XVKGXSRVWSSDNX-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|