C31H25Cl2N3O2 — CID 121471631
methyl 3-[2-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]ethyl]benzoate (PubChem CID 121471631) has the molecular formula C31H25Cl2N3O2 and a molecular weight of 542.47 g/mol. Its IUPAC name is methyl 3-[2-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]ethyl]benzoate.
| Compound Name | methyl 3-[2-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 121471631 |
| Molecular Formula | C31H25Cl2N3O2 |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | methyl 3-[2-[[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]amino]ethyl]benzoate |
| SMILES | COC(=O)c1cccc(CCNc2cnnc3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)c1 |
| InChI | InChI=1S/C31H25Cl2N3O2/c1-38-31(37)24-4-2-3-20(17-24)15-16-34-29-19-35-36-28-14-9-23(18-27(28)29)30(21-5-10-25(32)11-6-21)22-7-12-26(33)13-8-22/h2-14,17-19,30H,15-16H2,1H3,(H,34,36) |
| InChIKey | IYWUPZXBDQHLEU-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|