C15H12ClN3O2S — CID 58629113
methyl 4-[[(5-chlorothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzoate (PubChem CID 58629113) has the molecular formula C15H12ClN3O2S and a molecular weight of 333.80 g/mol. Its IUPAC name is methyl 4-[[(5-chlorothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzoate.
| Compound Name | methyl 4-[[(5-chlorothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 58629113 |
| Molecular Formula | C15H12ClN3O2S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | methyl 4-[[(5-chlorothieno[2,3-d]pyrimidin-4-yl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNc2ncnc3scc(Cl)c23)cc1 |
| InChI | InChI=1S/C15H12ClN3O2S/c1-21-15(20)10-4-2-9(3-5-10)6-17-13-12-11(16)7-22-14(12)19-8-18-13/h2-5,7-8H,6H2,1H3,(H,17,18,19) |
| InChIKey | BUJXIRNSIKNMBH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |