C9H8ClN3S — CID 15746030
5-chloro-N-prop-2-enylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 15746030) has the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. Its IUPAC name is 5-chloro-N-prop-2-enylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-chloro-N-prop-2-enylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 15746030 |
| Molecular Formula | C9H8ClN3S |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 5-chloro-N-prop-2-enylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | C=CCNc1ncnc2scc(Cl)c12 |
| InChI | InChI=1S/C9H8ClN3S/c1-2-3-11-8-7-6(10)4-14-9(7)13-5-12-8/h2,4-5H,1,3H2,(H,11,12,13) |
| InChIKey | AZCDNMQVKIMNRN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|