About 2-methyl-N-prop-2-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine
2-methyl-N-prop-2-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine (PubChem CID 131113927) has the molecular formula C9H10N4S
and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-methyl-N-prop-2-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 2-methyl-N-prop-2-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
| PubChem CID | 131113927 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 2-methyl-N-prop-2-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
| SMILES | C=CCNc1ncnc2sc(C)nc12 |
| InChI | InChI=1S/C9H10N4S/c1-3-4-10-8-7-9(12-5-11-8)14-6(2)13-7/h3,5H,1,4H2,2H3,(H,10,11,12) |
| InChIKey | IQPSRIPFYCFQQJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-prop-2-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-prop-2-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine?
The IUPAC name of 2-methyl-N-prop-2-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine (CID 131113927) is 2-methyl-N-prop-2-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine.
What is the SMILES notation for 2-methyl-N-prop-2-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine?
The canonical SMILES for 2-methyl-N-prop-2-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine is C=CCNc1ncnc2sc(C)nc12.
What is the InChIKey of 2-methyl-N-prop-2-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine?
The InChIKey is IQPSRIPFYCFQQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4S/c1-3-4-10-8-7-9(12-5-11-8)14-6(2)13-7/h3,5H,1,4H2,2H3,(H,10,11,12).
What are the key properties of 2-methyl-N-prop-2-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine?
2-methyl-N-prop-2-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine has a molecular weight of 206.27 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-prop-2-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine is sourced from PubChem (CID 131113927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).