C10H12N4 — CID 130978964
6-methyl-N-prop-2-enyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 130978964) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 6-methyl-N-prop-2-enyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-methyl-N-prop-2-enyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 130978964 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 6-methyl-N-prop-2-enyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | C=CCNc1ncnc2cc(C)[nH]c12 |
| InChI | InChI=1S/C10H12N4/c1-3-4-11-10-9-8(12-6-13-10)5-7(2)14-9/h3,5-6,14H,1,4H2,2H3,(H,11,12,13) |
| InChIKey | HKCPWFLBGDDVCD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|