C7H10N2S — CID 3101501
5-methyl-N-prop-2-enyl-1,3-thiazol-2-amine (PubChem CID 3101501) has the molecular formula C7H10N2S and a molecular weight of 154.24 g/mol. Its IUPAC name is 5-methyl-N-prop-2-enyl-1,3-thiazol-2-amine.
| Compound Name | 5-methyl-N-prop-2-enyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 3101501 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 5-methyl-N-prop-2-enyl-1,3-thiazol-2-amine |
| SMILES | C=CCNc1ncc(C)s1 |
| InChI | InChI=1S/C7H10N2S/c1-3-4-8-7-9-5-6(2)10-7/h3,5H,1,4H2,2H3,(H,8,9) |
| InChIKey | LUWRPZNSOAHZAR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|