C11H19N5 — CID 22540214
4-N-tert-butyl-6-N-prop-2-enylpyrimidine-4,5,6-triamine (PubChem CID 22540214) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 4-N-tert-butyl-6-N-prop-2-enylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N-tert-butyl-6-N-prop-2-enylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22540214 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 4-N-tert-butyl-6-N-prop-2-enylpyrimidine-4,5,6-triamine |
| SMILES | C=CCNc1ncnc(NC(C)(C)C)c1N |
| InChI | InChI=1S/C11H19N5/c1-5-6-13-9-8(12)10(15-7-14-9)16-11(2,3)4/h5,7H,1,6,12H2,2-4H3,(H2,13,14,15,16) |
| InChIKey | KCLJPAGCPDZPJJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|