C11H14N6O — CID 22540447
4-N-(5-methyl-1,2-oxazol-3-yl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine (PubChem CID 22540447) has the molecular formula C11H14N6O and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-N-(5-methyl-1,2-oxazol-3-yl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(5-methyl-1,2-oxazol-3-yl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22540447 |
| Molecular Formula | C11H14N6O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 4-N-(5-methyl-1,2-oxazol-3-yl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine |
| SMILES | C=CCNc1ncnc(Nc2cc(C)on2)c1N |
| InChI | InChI=1S/C11H14N6O/c1-3-4-13-10-9(12)11(15-6-14-10)16-8-5-7(2)18-17-8/h3,5-6H,1,4,12H2,2H3,(H2,13,14,15,16,17) |
| InChIKey | LWXWZZABGXFOKK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|