C9H10N4 — CID 76848839
N-prop-2-enyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 76848839) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is N-prop-2-enyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-prop-2-enyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 76848839 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | N-prop-2-enyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C=CCNc1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C9H10N4/c1-2-4-10-8-7-3-5-11-9(7)13-6-12-8/h2-3,5-6H,1,4H2,(H2,10,11,12,13) |
| InChIKey | KSRKOYHYVMRUII-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|