C14H16N4 — CID 143080878
N-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 143080878) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is N-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 143080878 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C=C/C(C)=C\C=C(/C)Nc1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C14H16N4/c1-4-10(2)5-6-11(3)18-14-12-7-8-15-13(12)16-9-17-14/h4-9H,1H2,2-3H3,(H2,15,16,17,18)/b10-5-,11-6+ |
| InChIKey | WPLBNOHLCYFTAP-JZKFVHIFSA-N |
| XLogP | 3.41 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|