C15H21N5 — CID 151798997
N-[(3R)-3-methyl-1-prop-2-enylpiperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 151798997) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is N-[(3R)-3-methyl-1-prop-2-enylpiperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(3R)-3-methyl-1-prop-2-enylpiperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 151798997 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | N-[(3R)-3-methyl-1-prop-2-enylpiperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C=CCN1CCC[C@@](C)(Nc2ncnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C15H21N5/c1-3-8-20-9-4-6-15(2,10-20)19-14-12-5-7-16-13(12)17-11-18-14/h3,5,7,11H,1,4,6,8-10H2,2H3,(H2,16,17,18,19)/t15-/m1/s1 |
| InChIKey | RYFBIEATPWNEGG-OAHLLOKOSA-N |
| XLogP | 2.41 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|