C9H12N4 — CID 90136224
6-ethenyl-4-N-prop-2-enylpyrimidine-4,5-diamine (PubChem CID 90136224) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 6-ethenyl-4-N-prop-2-enylpyrimidine-4,5-diamine.
| Compound Name | 6-ethenyl-4-N-prop-2-enylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 90136224 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 6-ethenyl-4-N-prop-2-enylpyrimidine-4,5-diamine |
| SMILES | C=CCNc1ncnc(C=C)c1N |
| InChI | InChI=1S/C9H12N4/c1-3-5-11-9-8(10)7(4-2)12-6-13-9/h3-4,6H,1-2,5,10H2,(H,11,12,13) |
| InChIKey | YTSPEZSFSXCQJQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|