C13H14FN5 — CID 19135993
4-N-(2-fluorophenyl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine (PubChem CID 19135993) has the molecular formula C13H14FN5 and a molecular weight of 259.29 g/mol. Its IUPAC name is 4-N-(2-fluorophenyl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(2-fluorophenyl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19135993 |
| Molecular Formula | C13H14FN5 |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-N-(2-fluorophenyl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine |
| SMILES | C=CCNc1ncnc(Nc2ccccc2F)c1N |
| InChI | InChI=1S/C13H14FN5/c1-2-7-16-12-11(15)13(18-8-17-12)19-10-6-4-3-5-9(10)14/h2-6,8H,1,7,15H2,(H2,16,17,18,19) |
| InChIKey | HUBZIDOEFHBCQH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|