C15H19N5 — CID 22544255
4-N-(4-ethylphenyl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine (PubChem CID 22544255) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is 4-N-(4-ethylphenyl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(4-ethylphenyl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22544255 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 4-N-(4-ethylphenyl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine |
| SMILES | C=CCNc1ncnc(Nc2ccc(CC)cc2)c1N |
| InChI | InChI=1S/C15H19N5/c1-3-9-17-14-13(16)15(19-10-18-14)20-12-7-5-11(4-2)6-8-12/h3,5-8,10H,1,4,9,16H2,2H3,(H2,17,18,19,20) |
| InChIKey | XDAVZLOLMYUWKU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|