About [7-(ethylamino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]methanol
[7-(ethylamino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]methanol (PubChem CID 130664207) has the molecular formula C8H10N4OS
and a molecular weight of 210.26 g/mol. Its IUPAC name is [7-(ethylamino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]methanol.
Molecular Properties
| Compound Name | [7-(ethylamino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]methanol |
| PubChem CID | 130664207 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | [7-(ethylamino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]methanol |
| SMILES | CCNc1ncnc2sc(CO)nc12 |
| InChI | InChI=1S/C8H10N4OS/c1-2-9-7-6-8(11-4-10-7)14-5(3-13)12-6/h4,13H,2-3H2,1H3,(H,9,10,11) |
| InChIKey | FGQYEAPFMCZHEU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [7-(ethylamino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(ethylamino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]methanol?
The IUPAC name of [7-(ethylamino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]methanol (CID 130664207) is [7-(ethylamino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]methanol.
What is the SMILES notation for [7-(ethylamino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]methanol?
The canonical SMILES for [7-(ethylamino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]methanol is CCNc1ncnc2sc(CO)nc12.
What is the InChIKey of [7-(ethylamino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]methanol?
The InChIKey is FGQYEAPFMCZHEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4OS/c1-2-9-7-6-8(11-4-10-7)14-5(3-13)12-6/h4,13H,2-3H2,1H3,(H,9,10,11).
What are the key properties of [7-(ethylamino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]methanol?
[7-(ethylamino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]methanol has a molecular weight of 210.26 g/mol, XLogP of 1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(ethylamino)-[1,3]thiazolo[5,4-d]pyrimidin-2-yl]methanol is sourced from PubChem (CID 130664207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).