C9H10N4S — CID 130748325
N-but-3-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine (PubChem CID 130748325) has the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. Its IUPAC name is N-but-3-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine.
| Compound Name | N-but-3-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 130748325 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | N-but-3-enyl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
| SMILES | C=CCCNc1ncnc2scnc12 |
| InChI | InChI=1S/C9H10N4S/c1-2-3-4-10-8-7-9(12-5-11-8)14-6-13-7/h2,5-6H,1,3-4H2,(H,10,11,12) |
| InChIKey | CYMNNJMBZGTMKM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|