C8H10N4OS — CID 131026666
3-([1,3]thiazolo[5,4-d]pyrimidin-7-ylamino)propan-1-ol (PubChem CID 131026666) has the molecular formula C8H10N4OS and a molecular weight of 210.26 g/mol. Its IUPAC name is 3-([1,3]thiazolo[5,4-d]pyrimidin-7-ylamino)propan-1-ol.
| Compound Name | 3-([1,3]thiazolo[5,4-d]pyrimidin-7-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 131026666 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 3-([1,3]thiazolo[5,4-d]pyrimidin-7-ylamino)propan-1-ol |
| SMILES | OCCCNc1ncnc2scnc12 |
| InChI | InChI=1S/C8H10N4OS/c13-3-1-2-9-7-6-8(11-4-10-7)14-5-12-6/h4-5,13H,1-3H2,(H,9,10,11) |
| InChIKey | IDDQYDLSLGOWSV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|