C8H10BrN3 — CID 106196154
6-bromo-N-but-3-enylpyrimidin-4-amine (PubChem CID 106196154) has the molecular formula C8H10BrN3 and a molecular weight of 228.09 g/mol. Its IUPAC name is 6-bromo-N-but-3-enylpyrimidin-4-amine.
| Compound Name | 6-bromo-N-but-3-enylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106196154 |
| Molecular Formula | C8H10BrN3 |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | 6-bromo-N-but-3-enylpyrimidin-4-amine |
| SMILES | C=CCCNc1cc(Br)ncn1 |
| InChI | InChI=1S/C8H10BrN3/c1-2-3-4-10-8-5-7(9)11-6-12-8/h2,5-6H,1,3-4H2,(H,10,11,12) |
| InChIKey | IIHCDAUHKAZUFH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|