C9H7ClN2OS — CID 15745803
5-chloro-4-prop-2-enoxythieno[2,3-d]pyrimidine (PubChem CID 15745803) has the molecular formula C9H7ClN2OS and a molecular weight of 226.69 g/mol. Its IUPAC name is 5-chloro-4-prop-2-enoxythieno[2,3-d]pyrimidine.
| Compound Name | 5-chloro-4-prop-2-enoxythieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 15745803 |
| Molecular Formula | C9H7ClN2OS |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 5-chloro-4-prop-2-enoxythieno[2,3-d]pyrimidine |
| SMILES | C=CCOc1ncnc2scc(Cl)c12 |
| InChI | InChI=1S/C9H7ClN2OS/c1-2-3-13-8-7-6(10)4-14-9(7)12-5-11-8/h2,4-5H,1,3H2 |
| InChIKey | IEKHPQNWIFQUST-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|