C16H15ClN2OS — CID 58629011
2-benzyl-3-(5-chlorothieno[2,3-d]pyrimidin-4-yl)propan-1-ol (PubChem CID 58629011) has the molecular formula C16H15ClN2OS and a molecular weight of 318.83 g/mol. Its IUPAC name is 2-benzyl-3-(5-chlorothieno[2,3-d]pyrimidin-4-yl)propan-1-ol.
| Compound Name | 2-benzyl-3-(5-chlorothieno[2,3-d]pyrimidin-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 58629011 |
| Molecular Formula | C16H15ClN2OS |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-benzyl-3-(5-chlorothieno[2,3-d]pyrimidin-4-yl)propan-1-ol |
| SMILES | OCC(Cc1ccccc1)Cc1ncnc2scc(Cl)c12 |
| InChI | InChI=1S/C16H15ClN2OS/c17-13-9-21-16-15(13)14(18-10-19-16)7-12(8-20)6-11-4-2-1-3-5-11/h1-5,9-10,12,20H,6-8H2 |
| InChIKey | HJWGAOXUWHEOKR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |