C13H9ClN2S — CID 708732
4-chloro-5-(4-methylphenyl)thieno[2,3-d]pyrimidine (PubChem CID 708732) has the molecular formula C13H9ClN2S and a molecular weight of 260.75 g/mol. Its IUPAC name is 4-chloro-5-(4-methylphenyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-chloro-5-(4-methylphenyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 708732 |
| Molecular Formula | C13H9ClN2S |
| Molecular Weight | 260.75 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 4-chloro-5-(4-methylphenyl)thieno[2,3-d]pyrimidine |
| SMILES | Cc1ccc(-c2csc3ncnc(Cl)c23)cc1 |
| InChI | InChI=1S/C13H9ClN2S/c1-8-2-4-9(5-3-8)10-6-17-13-11(10)12(14)15-7-16-13/h2-7H,1H3 |
| InChIKey | IJQIOVCRRZEROH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.75 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |