C15H12N2O2S2 — CID 856427
methyl 2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate (PubChem CID 856427) has the molecular formula C15H12N2O2S2 and a molecular weight of 316.41 g/mol. Its IUPAC name is methyl 2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate.
| Compound Name | methyl 2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate |
|---|---|
| PubChem CID | 856427 |
| Molecular Formula | C15H12N2O2S2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | methyl 2-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylacetate |
| SMILES | COC(=O)CSc1ncnc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C15H12N2O2S2/c1-19-12(18)8-21-15-13-11(10-5-3-2-4-6-10)7-20-14(13)16-9-17-15/h2-7,9H,8H2,1H3 |
| InChIKey | GSJZDBNDELCNEI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |