C16H15FN2OS — CID 11551213
4-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]butan-1-ol (PubChem CID 11551213) has the molecular formula C16H15FN2OS and a molecular weight of 302.37 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]butan-1-ol.
| Compound Name | 4-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]butan-1-ol |
|---|---|
| PubChem CID | 11551213 |
| Molecular Formula | C16H15FN2OS |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]butan-1-ol |
| SMILES | OCCCCc1ncnc2scc(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C16H15FN2OS/c17-12-6-4-11(5-7-12)13-9-21-16-15(13)14(18-10-19-16)3-1-2-8-20/h4-7,9-10,20H,1-3,8H2 |
| InChIKey | RCUDCNNBMDZSCL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|