C13H17ClN4 — CID 87329948
6-chloro-4-N,5-N,5-N-tris(prop-2-enyl)pyrimidine-4,5-diamine (PubChem CID 87329948) has the molecular formula C13H17ClN4 and a molecular weight of 264.76 g/mol. Its IUPAC name is 6-chloro-4-N,5-N,5-N-tris(prop-2-enyl)pyrimidine-4,5-diamine.
| Compound Name | 6-chloro-4-N,5-N,5-N-tris(prop-2-enyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 87329948 |
| Molecular Formula | C13H17ClN4 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 6-chloro-4-N,5-N,5-N-tris(prop-2-enyl)pyrimidine-4,5-diamine |
| SMILES | C=CCNc1ncnc(Cl)c1N(CC=C)CC=C |
| InChI | InChI=1S/C13H17ClN4/c1-4-7-15-13-11(12(14)16-10-17-13)18(8-5-2)9-6-3/h4-6,10H,1-3,7-9H2,(H,15,16,17) |
| InChIKey | BQADYLZKTDPOJW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|