C34H36Cl2F3N3O2 — CID 162207082
6-[bis(4-chlorophenyl)methyl]-2-methoxy-8-(3-methoxypropyl)-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]quinolin-4-amine (PubChem CID 162207082) has the molecular formula C34H36Cl2F3N3O2 and a molecular weight of 646.58 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-2-methoxy-8-(3-methoxypropyl)-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]quinolin-4-amine.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-2-methoxy-8-(3-methoxypropyl)-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]quinolin-4-amine |
|---|---|
| PubChem CID | 162207082 |
| Molecular Formula | C34H36Cl2F3N3O2 |
| Molecular Weight | 646.58 g/mol |
| Exact Mass | 645.21 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-2-methoxy-8-(3-methoxypropyl)-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]quinolin-4-amine |
| SMILES | COCCCc1cc(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc2c(NC3CCN(CC(F)(F)F)CC3)cc(OC)nc12 |
| InChI | InChI=1S/C34H36Cl2F3N3O2/c1-43-17-3-4-24-18-25(32(22-5-9-26(35)10-6-22)23-7-11-27(36)12-8-23)19-29-30(20-31(44-2)41-33(24)29)40-28-13-15-42(16-14-28)21-34(37,38)39/h5-12,18-20,28,32H,3-4,13-17,21H2,1-2H3,(H,40,41) |
| InChIKey | ZSIJXYCHGBLXNF-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.58 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|