C31H29Cl2F3N4O2 — CID 158254602
2-[6-[bis(4-chlorophenyl)methyl]-2-oxo-4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]quinolin-1-yl]acetamide (PubChem CID 158254602) has the molecular formula C31H29Cl2F3N4O2 and a molecular weight of 617.50 g/mol. Its IUPAC name is 2-[6-[bis(4-chlorophenyl)methyl]-2-oxo-4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]quinolin-1-yl]acetamide.
| Compound Name | 2-[6-[bis(4-chlorophenyl)methyl]-2-oxo-4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]quinolin-1-yl]acetamide |
|---|---|
| PubChem CID | 158254602 |
| Molecular Formula | C31H29Cl2F3N4O2 |
| Molecular Weight | 617.50 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | 2-[6-[bis(4-chlorophenyl)methyl]-2-oxo-4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]quinolin-1-yl]acetamide |
| SMILES | NC(=O)Cn1c(=O)cc(NC2CCN(CC(F)(F)F)CC2)c2cc(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)ccc21 |
| InChI | InChI=1S/C31H29Cl2F3N4O2/c32-22-6-1-19(2-7-22)30(20-3-8-23(33)9-4-20)21-5-10-27-25(15-21)26(16-29(42)40(27)17-28(37)41)38-24-11-13-39(14-12-24)18-31(34,35)36/h1-10,15-16,24,30,38H,11-14,17-18H2,(H2,37,41) |
| InChIKey | GHCXSMCBZJDUGE-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|