C42H51Cl2F3N4O4S — CID 126655927
tert-butyl N-[2-[3-[6-[bis(4-chlorophenyl)methyl]-2-oxo-4-[[1-(trifluoromethylsulfanyl)piperidin-4-yl]amino]quinolin-1-yl]-3-methylbutoxy]-2-methylpropyl]carbamate (PubChem CID 126655927) has the molecular formula C42H51Cl2F3N4O4S and a molecular weight of 835.86 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[6-[bis(4-chlorophenyl)methyl]-2-oxo-4-[[1-(trifluoromethylsulfanyl)piperidin-4-yl]amino]quinolin-1-yl]-3-methylbutoxy]-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[6-[bis(4-chlorophenyl)methyl]-2-oxo-4-[[1-(trifluoromethylsulfanyl)piperidin-4-yl]amino]quinolin-1-yl]-3-methylbutoxy]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 126655927 |
| Molecular Formula | C42H51Cl2F3N4O4S |
| Molecular Weight | 835.86 g/mol |
| Exact Mass | 834.30 |
| IUPAC Name | tert-butyl N-[2-[3-[6-[bis(4-chlorophenyl)methyl]-2-oxo-4-[[1-(trifluoromethylsulfanyl)piperidin-4-yl]amino]quinolin-1-yl]-3-methylbutoxy]-2-methylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(C)(C)OCCC(C)(C)n1c(=O)cc(NC2CCN(SC(F)(F)F)CC2)c2cc(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)ccc21 |
| InChI | InChI=1S/C42H51Cl2F3N4O4S/c1-39(2,3)55-38(53)48-26-41(6,7)54-23-20-40(4,5)51-35-17-12-29(37(27-8-13-30(43)14-9-27)28-10-15-31(44)16-11-28)24-33(35)34(25-36(51)52)49-32-18-21-50(22-19-32)56-42(45,46)47/h8-17,24-25,32,37,49H,18-23,26H2,1-7H3,(H,48,53) |
| InChIKey | HMLCJLGHXIGVQM-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.86 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|