C35H42Cl2N4OS — CID 145265506
N-[1-(1-aminoethylsulfanyl)piperidin-4-yl]-6-[bis(4-chlorophenyl)methyl]-2-(2-methylpentan-2-yloxy)quinolin-4-amine (PubChem CID 145265506) has the molecular formula C35H42Cl2N4OS and a molecular weight of 637.72 g/mol. Its IUPAC name is N-[1-(1-aminoethylsulfanyl)piperidin-4-yl]-6-[bis(4-chlorophenyl)methyl]-2-(2-methylpentan-2-yloxy)quinolin-4-amine.
| Compound Name | N-[1-(1-aminoethylsulfanyl)piperidin-4-yl]-6-[bis(4-chlorophenyl)methyl]-2-(2-methylpentan-2-yloxy)quinolin-4-amine |
|---|---|
| PubChem CID | 145265506 |
| Molecular Formula | C35H42Cl2N4OS |
| Molecular Weight | 637.72 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | N-[1-(1-aminoethylsulfanyl)piperidin-4-yl]-6-[bis(4-chlorophenyl)methyl]-2-(2-methylpentan-2-yloxy)quinolin-4-amine |
| SMILES | CCCC(C)(C)Oc1cc(NC2CCN(SC(C)N)CC2)c2cc(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)ccc2n1 |
| InChI | InChI=1S/C35H42Cl2N4OS/c1-5-18-35(3,4)42-33-22-32(39-29-16-19-41(20-17-29)43-23(2)38)30-21-26(10-15-31(30)40-33)34(24-6-11-27(36)12-7-24)25-8-13-28(37)14-9-25/h6-15,21-23,29,34H,5,16-20,38H2,1-4H3,(H,39,40) |
| InChIKey | LDRHIUXCKLRAAY-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.72 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|