C33H30Cl2N4 — CID 162657050
4-N-[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]-1-N-phenylcyclohexane-1,4-diamine (PubChem CID 162657050) has the molecular formula C33H30Cl2N4 and a molecular weight of 553.54 g/mol. Its IUPAC name is 4-N-[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]-1-N-phenylcyclohexane-1,4-diamine.
| Compound Name | 4-N-[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]-1-N-phenylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 162657050 |
| Molecular Formula | C33H30Cl2N4 |
| Molecular Weight | 553.54 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 4-N-[6-[bis(4-chlorophenyl)methyl]cinnolin-4-yl]-1-N-phenylcyclohexane-1,4-diamine |
| SMILES | Clc1ccc(C(c2ccc(Cl)cc2)c2ccc3nncc(NC4CCC(Nc5ccccc5)CC4)c3c2)cc1 |
| InChI | InChI=1S/C33H30Cl2N4/c34-25-11-6-22(7-12-25)33(23-8-13-26(35)14-9-23)24-10-19-31-30(20-24)32(21-36-39-31)38-29-17-15-28(16-18-29)37-27-4-2-1-3-5-27/h1-14,19-21,28-29,33,37H,15-18H2,(H,38,39) |
| InChIKey | NQSYNOBJGHEEQR-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.54 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|