C33H30Cl2N2O4 — CID 126617687
6-[bis(4-chlorophenyl)methyl]-4-[4-[2-(2-methoxyethoxy)ethoxy]anilino]-1H-quinolin-2-one (PubChem CID 126617687) has the molecular formula C33H30Cl2N2O4 and a molecular weight of 589.52 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-4-[4-[2-(2-methoxyethoxy)ethoxy]anilino]-1H-quinolin-2-one.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-4-[4-[2-(2-methoxyethoxy)ethoxy]anilino]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 126617687 |
| Molecular Formula | C33H30Cl2N2O4 |
| Molecular Weight | 589.52 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-4-[4-[2-(2-methoxyethoxy)ethoxy]anilino]-1H-quinolin-2-one |
| SMILES | COCCOCCOc1ccc(Nc2cc(=O)[nH]c3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)cc1 |
| InChI | InChI=1S/C33H30Cl2N2O4/c1-39-16-17-40-18-19-41-28-13-11-27(12-14-28)36-31-21-32(38)37-30-15-6-24(20-29(30)31)33(22-2-7-25(34)8-3-22)23-4-9-26(35)10-5-23/h2-15,20-21,33H,16-19H2,1H3,(H2,36,37,38) |
| InChIKey | BVNLGEPDFRSYRR-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.52 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|