C30H23Cl2N3O2 — CID 118324045
2-[4-[[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]amino]phenyl]acetamide (PubChem CID 118324045) has the molecular formula C30H23Cl2N3O2 and a molecular weight of 528.44 g/mol. Its IUPAC name is 2-[4-[[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]amino]phenyl]acetamide.
| Compound Name | 2-[4-[[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 118324045 |
| Molecular Formula | C30H23Cl2N3O2 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 2-[4-[[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]amino]phenyl]acetamide |
| SMILES | NC(=O)Cc1ccc(Nc2cc(=O)[nH]c3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)cc1 |
| InChI | InChI=1S/C30H23Cl2N3O2/c31-22-8-3-19(4-9-22)30(20-5-10-23(32)11-6-20)21-7-14-26-25(16-21)27(17-29(37)35-26)34-24-12-1-18(2-13-24)15-28(33)36/h1-14,16-17,30H,15H2,(H2,33,36)(H2,34,35,37) |
| InChIKey | NROPRVDZXGJHLE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|