C29H21Cl2N3O2 — CID 118323947
4-[[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]amino]benzamide (PubChem CID 118323947) has the molecular formula C29H21Cl2N3O2 and a molecular weight of 514.41 g/mol. Its IUPAC name is 4-[[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]amino]benzamide.
| Compound Name | 4-[[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 118323947 |
| Molecular Formula | C29H21Cl2N3O2 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | 4-[[6-[bis(4-chlorophenyl)methyl]-2-oxo-1H-quinolin-4-yl]amino]benzamide |
| SMILES | NC(=O)c1ccc(Nc2cc(=O)[nH]c3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)cc1 |
| InChI | InChI=1S/C29H21Cl2N3O2/c30-21-8-1-17(2-9-21)28(18-3-10-22(31)11-4-18)20-7-14-25-24(15-20)26(16-27(35)34-25)33-23-12-5-19(6-13-23)29(32)36/h1-16,28H,(H2,32,36)(H2,33,34,35) |
| InChIKey | BLTDUYASEOYHKZ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|