C18H20Cl2N2O3S — CID 71068252
[5-chloro-2-[[1-(3-chlorophenyl)sulfonylpiperidin-4-yl]amino]phenyl]methanol (PubChem CID 71068252) has the molecular formula C18H20Cl2N2O3S and a molecular weight of 415.34 g/mol. Its IUPAC name is [5-chloro-2-[[1-(3-chlorophenyl)sulfonylpiperidin-4-yl]amino]phenyl]methanol.
| Compound Name | [5-chloro-2-[[1-(3-chlorophenyl)sulfonylpiperidin-4-yl]amino]phenyl]methanol |
|---|---|
| PubChem CID | 71068252 |
| Molecular Formula | C18H20Cl2N2O3S |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | [5-chloro-2-[[1-(3-chlorophenyl)sulfonylpiperidin-4-yl]amino]phenyl]methanol |
| SMILES | O=S(=O)(c1cccc(Cl)c1)N1CCC(Nc2ccc(Cl)cc2CO)CC1 |
| InChI | InChI=1S/C18H20Cl2N2O3S/c19-14-2-1-3-17(11-14)26(24,25)22-8-6-16(7-9-22)21-18-5-4-15(20)10-13(18)12-23/h1-5,10-11,16,21,23H,6-9,12H2 |
| InChIKey | RDSCOQQDNJNYGA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |