C14H18ClN3O2S2 — CID 8745836
4-(3-chlorophenyl)sulfonyl-N-cyclopropylpiperazine-1-carbothioamide (PubChem CID 8745836) has the molecular formula C14H18ClN3O2S2 and a molecular weight of 359.90 g/mol. Its IUPAC name is 4-(3-chlorophenyl)sulfonyl-N-cyclopropylpiperazine-1-carbothioamide.
| Compound Name | 4-(3-chlorophenyl)sulfonyl-N-cyclopropylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8745836 |
| Molecular Formula | C14H18ClN3O2S2 |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 4-(3-chlorophenyl)sulfonyl-N-cyclopropylpiperazine-1-carbothioamide |
| SMILES | O=S(=O)(c1cccc(Cl)c1)N1CCN(C(=S)NC2CC2)CC1 |
| InChI | InChI=1S/C14H18ClN3O2S2/c15-11-2-1-3-13(10-11)22(19,20)18-8-6-17(7-9-18)14(21)16-12-4-5-12/h1-3,10,12H,4-9H2,(H,16,21) |
| InChIKey | HCRQFBZITNEQAI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|