C18H25N3O2S2 — CID 8813036
N-cyclopropyl-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazine-1-carbothioamide (PubChem CID 8813036) has the molecular formula C18H25N3O2S2 and a molecular weight of 379.55 g/mol. Its IUPAC name is N-cyclopropyl-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazine-1-carbothioamide.
| Compound Name | N-cyclopropyl-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8813036 |
| Molecular Formula | C18H25N3O2S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-cyclopropyl-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazine-1-carbothioamide |
| SMILES | O=S(=O)(c1ccc2c(c1)CCCC2)N1CCN(C(=S)NC2CC2)CC1 |
| InChI | InChI=1S/C18H25N3O2S2/c22-25(23,17-8-5-14-3-1-2-4-15(14)13-17)21-11-9-20(10-12-21)18(24)19-16-6-7-16/h5,8,13,16H,1-4,6-7,9-12H2,(H,19,24) |
| InChIKey | LRJWUSGBWFKNCB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|