C17H15F3N2O — CID 86342434
7-[3-(trifluoromethyl)anilino]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 86342434) has the molecular formula C17H15F3N2O and a molecular weight of 320.31 g/mol. Its IUPAC name is 7-[3-(trifluoromethyl)anilino]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-[3-(trifluoromethyl)anilino]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 86342434 |
| Molecular Formula | C17H15F3N2O |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 7-[3-(trifluoromethyl)anilino]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1CCCc2cc(Nc3cccc(C(F)(F)F)c3)ccc2N1 |
| InChI | InChI=1S/C17H15F3N2O/c18-17(19,20)12-4-2-5-13(10-12)21-14-7-8-15-11(9-14)3-1-6-16(23)22-15/h2,4-5,7-10,21H,1,3,6H2,(H,22,23) |
| InChIKey | JEFSRAHXCRPPJJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |